Products 80245-28-9
CAS 80245-28-9 appears in our catalog under these names: 2,3-Dimethylbenzotrifluoride, 95%, 2,3-Dimethylbenzotrifluoride, >95% (HPLC). Offered by: Combi-blocks, TRC. Available pack sizes: 10g, 5g, 1g, 100mg, 500mg.
1,2-dimethyl-3-(trifluoromethyl)benzene (CAS 80245-28-9) is a chemical compound with the molecular formula C9H9F3 and a molecular weight of 174.16 g/mol. IUPAC name: 1,2-dimethyl-3-(trifluoromethyl)benzene. InChIKey: VERXMJNGDGKQBH-UHFFFAOYSA-N.
| Molecular formula | C9H9F3 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,2-dimethyl-3-(trifluoromethyl)benzene |
| InChIKey | VERXMJNGDGKQBH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(F)(F)F)C |
Computed by PubChem (NCBI)