CAS 93841-19-1 is the registry number for 2,4-Dimethylbenzotrilfuoride, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
2,4-dimethyl-1-(trifluoromethyl)benzene (CAS 93841-19-1) is a chemical compound with the molecular formula C9H9F3 and a molecular weight of 174.16 g/mol. IUPAC name: 2,4-dimethyl-1-(trifluoromethyl)benzene. InChIKey: MMNSBYZZXGPGEK-UHFFFAOYSA-N.
| Molecular formula | C9H9F3 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 2,4-dimethyl-1-(trifluoromethyl)benzene |
| InChIKey | MMNSBYZZXGPGEK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(F)(F)F)C |
Computed by PubChem (NCBI)