CAS 80277-45-8 is the registry number for 3-Chloro-4-fluorobenzoyl cyanide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-chloro-4-fluorobenzoyl cyanide (CAS 80277-45-8) is a chemical compound with the molecular formula C8H3ClFNO and a molecular weight of 183.56 g/mol. IUPAC name: 3-chloro-4-fluorobenzoyl cyanide. InChIKey: BGSVXOFUWAZGGW-UHFFFAOYSA-N.
| Molecular formula | C8H3ClFNO |
|---|---|
| Molecular weight | 183.56 g/mol |
| IUPAC name | 3-chloro-4-fluorobenzoyl cyanide |
| InChIKey | BGSVXOFUWAZGGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C#N)Cl)F |
Computed by PubChem (NCBI)