Products 80277-45-8

CAS 80277-45-8 is the registry number for 3-Chloro-4-fluorobenzoyl cyanide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-chloro-4-fluorobenzoyl cyanide (CAS 80277-45-8) is a chemical compound with the molecular formula C8H3ClFNO and a molecular weight of 183.56 g/mol. IUPAC name: 3-chloro-4-fluorobenzoyl cyanide. InChIKey: BGSVXOFUWAZGGW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3ClFNO
Molecular weight183.56 g/mol
IUPAC name3-chloro-4-fluorobenzoyl cyanide
InChIKeyBGSVXOFUWAZGGW-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)C#N)Cl)F

Computed by PubChem (NCBI)