CAS 924626-91-5 appears in our catalog under these names: 2-Chloro-4-fluoro-3-formylbenzonitrile, 96%, 2–Chloro–4–fluoro–3–formylbenzonitrile, 2-Chloro-4-fluoro-3-formylbenzonitrile. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg.
2-chloro-4-fluoro-3-formylbenzonitrile (CAS 924626-91-5) is a chemical compound with the molecular formula C8H3ClFNO and a molecular weight of 183.56 g/mol. IUPAC name: 2-chloro-4-fluoro-3-formylbenzonitrile. InChIKey: PDOGRPSEJGJZJC-UHFFFAOYSA-N.
| Molecular formula | C8H3ClFNO |
|---|---|
| Molecular weight | 183.56 g/mol |
| IUPAC name | 2-chloro-4-fluoro-3-formylbenzonitrile |
| InChIKey | PDOGRPSEJGJZJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)Cl)C=O)F |
Computed by PubChem (NCBI)