CAS 80284-15-7 is the registry number for 3-(tert-Butyl)-5-methoxybenzene-1,2-diol. Offered by: TRC. Available pack sizes: 50mg.
3-tert-butyl-5-methoxybenzene-1,2-diol (CAS 80284-15-7) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: 3-tert-butyl-5-methoxybenzene-1,2-diol. InChIKey: CDUDTAOIPVCWDW-UHFFFAOYSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 3-tert-butyl-5-methoxybenzene-1,2-diol |
| InChIKey | CDUDTAOIPVCWDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC(=C1)OC)O)O |
Computed by PubChem (NCBI)