CAS 80446-58-8 is the registry number for (R)-2,2,2-Trifluoro-1-(4-methoxyphenyl)ethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanol (CAS 80446-58-8) is a chemical compound with the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanol. InChIKey: MCAYQVHHKRKRLD-MRVPVSSYSA-N.
| Molecular formula | C9H9F3O2 |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanol |
| InChIKey | MCAYQVHHKRKRLD-MRVPVSSYSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H](C(F)(F)F)O |
Computed by PubChem (NCBI)