CAS 80500-28-3 appears in our catalog under these names: 4-Carboxy-3-nitrophenylboronic acid, 95-<97%, 4-Carboxy-3-nitrophenylboronic acid, ≥97-<99%, 4-(Dihydroxyboryl)-2-nitrobenzoic acid, 95%, 4–Carboxy–3–nitrophenylboronic Acid (contains varying amounts of Anhydride), 4-Carboxy-3-nitrophenylboronic Acid (contains varying amounts of Anhydride). Offered by: Hoffman Fine Chemicals, Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 250mg, 5g.
4-borono-2-nitrobenzoic acid (CAS 80500-28-3) is a chemical compound with the molecular formula C7H6BNO6 and a molecular weight of 210.94 g/mol. IUPAC name: 4-borono-2-nitrobenzoic acid. InChIKey: APQGIZKNZHGXTG-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO6 |
|---|---|
| Molecular weight | 210.94 g/mol |
| IUPAC name | 4-borono-2-nitrobenzoic acid |
| InChIKey | APQGIZKNZHGXTG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)O)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)