Products 85107-54-6
CAS 85107-54-6 appears in our catalog under these names: 4–Carboxy–2–nitrobenzeneboronic acid (contains varying amounts of Anhydride), 4-Carboxy-2-nitrophenylboronic Acid (contains varying amounts of Anhydride), 4-Carboxy-2-nitrophenylboronic acid 97%, 4-Carboxy-2-Nitrophenylboronic Acid, 97%, 97%, 4-Carboxy-2-nitrophenylboronic acid, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
4-borono-3-nitrobenzoic acid (CAS 85107-54-6) is a chemical compound with the molecular formula C7H6BNO6 and a molecular weight of 210.94 g/mol. IUPAC name: 4-borono-3-nitrobenzoic acid. InChIKey: APBXPKJLXBBPQJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO6 |
|---|---|
| Molecular weight | 210.94 g/mol |
| IUPAC name | 4-borono-3-nitrobenzoic acid |
| InChIKey | APBXPKJLXBBPQJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Carboxy-2-nitrobenzeneboronic acid, 4-CO2H-2-Nbba, 4-carboxy-2-nitrophenylboronic acid, 4-borono-3-nitrobenzoic acid, Benzoic acid, 4-borono-3-nitro-, (4-Carboxy-2-nitrophenyl)boronic acid, 4-Carboxy-2-nitrobenzeneboronic acid (contains varying amounts of Anhydride), 4-borono-3-nitro-benzoic acid, 4-(dihydroxyboranyl)-3-nitrobenzoic acid, 4-Carboxy-2-nitrophenyl boronic acid