CAS 80530-55-8 appears in our catalog under these names: Loxoprofen Impurity 30, 2-(4-(Chloromethyl)phenyl)propanoic Acid, 2-(4-(Chloromethyl)phenyl)propanoic acid, 97%, 97%, 2-(4-CHLOROMETHYLPHENYL)PROPIONIC ACID, 97%. Offered by: Chemat Brand, TRC, Chemat, Fluorochem. Available pack sizes: on request, 250mg, 25mg, 100mg.
2-[4-(chloromethyl)phenyl]propanoic acid (CAS 80530-55-8) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 2-[4-(chloromethyl)phenyl]propanoic acid. InChIKey: KIFZXXOBDKAFPG-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 2-[4-(chloromethyl)phenyl]propanoic acid |
| InChIKey | KIFZXXOBDKAFPG-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)CCl)C(=O)O |
Computed by PubChem (NCBI)