CAS 80549-62-8 appears in our catalog under these names: 5-(4-tert-Butyl-phenoxymethyl)-[1,3,4]oxadiazole-2-thiol, 95%, 5-(4-tert-Butylphenoxymethyl)-1,3,4-oxadiazole-2-thiol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-[(4-tert-butylphenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione (CAS 80549-62-8) is a chemical compound with the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. IUPAC name: 5-[(4-tert-butylphenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione. InChIKey: SCIKBGWQQVYQRC-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2S |
|---|---|
| Molecular weight | 264.35 g/mol |
| IUPAC name | 5-[(4-tert-butylphenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | SCIKBGWQQVYQRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OCC2=NNC(=S)O2 |
Computed by PubChem (NCBI)