CAS 941073-81-0 is the registry number for N-(2-Amino-2-oxoethyl)-2-((2,3-dihydro-1H-inden-5-yl)thio)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetyl]amino]acetamide (CAS 941073-81-0) is a chemical compound with the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. IUPAC name: 2-[[2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetyl]amino]acetamide. InChIKey: KXVNFVRKBOWYJD-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2S |
|---|---|
| Molecular weight | 264.35 g/mol |
| IUPAC name | 2-[[2-(2,3-dihydro-1H-inden-5-ylsulfanyl)acetyl]amino]acetamide |
| InChIKey | KXVNFVRKBOWYJD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)SCC(=O)NCC(=O)N |
Computed by PubChem (NCBI)