CAS 80621-88-1 appears in our catalog under these names: 25-Desacetyl Rifaximin, Desacetyl Rifaximin, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
(E)-3-(4-methylphenyl)prop-2-enoyl azide (CAS 80621-88-1) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: (E)-3-(4-methylphenyl)prop-2-enoyl azide. InChIKey: IFVSVRKWJLKNIT-VOTSOKGWSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | (E)-3-(4-methylphenyl)prop-2-enoyl azide |
| InChIKey | IFVSVRKWJLKNIT-VOTSOKGWSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/C(=O)N=[N+]=[N-] |
Computed by PubChem (NCBI)