Products 807328-32-1

CAS 807328-32-1 is the registry number for Lincomycin Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R,4R)-4-propylpyrrolidine-2-carboxylic acid (CAS 807328-32-1) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: (2R,4R)-4-propylpyrrolidine-2-carboxylic acid. InChIKey: DQHUOKOFSXEEAW-RNFRBKRXSA-N.

Identity
Molecular formulaC8H15NO2
Molecular weight157.21 g/mol
IUPAC name(2R,4R)-4-propylpyrrolidine-2-carboxylic acid
InChIKeyDQHUOKOFSXEEAW-RNFRBKRXSA-N
SMILESCCC[C@@H]1C[C@@H](NC1)C(=O)O

Computed by PubChem (NCBI)