CAS 807328-32-1 is the registry number for Lincomycin Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4R)-4-propylpyrrolidine-2-carboxylic acid (CAS 807328-32-1) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: (2R,4R)-4-propylpyrrolidine-2-carboxylic acid. InChIKey: DQHUOKOFSXEEAW-RNFRBKRXSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | (2R,4R)-4-propylpyrrolidine-2-carboxylic acid |
| InChIKey | DQHUOKOFSXEEAW-RNFRBKRXSA-N |
| SMILES | CCC[C@@H]1C[C@@H](NC1)C(=O)O |
Computed by PubChem (NCBI)