CAS 807614-94-4 appears in our catalog under these names: 4-Dechloro-3-chloro indomethacin, >95% (HPLC), Indomethacin (Indometacin) EP Impurity E, Indometacin EP Impurity E, 2-(1-(3-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl)acetic acid, 95+%, Indomethacin Impurity 5(Indomethacin EP Impurity E). Offered by: TRC, Chemat Brand, Hubei YoungXin. Available pack sizes: 2,5mg, 25mg, on request, 10mg, 50mg, 100mg, 200mg.
2-[1-(3-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic acid (CAS 807614-94-4) is a chemical compound with the molecular formula C19H16ClNO4 and a molecular weight of 357.8 g/mol. IUPAC name: 2-[1-(3-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic acid. InChIKey: PXXTUBBLCCJTKH-UHFFFAOYSA-N.
| Molecular formula | C19H16ClNO4 |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 2-[1-(3-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic acid |
| InChIKey | PXXTUBBLCCJTKH-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC(=CC=C3)Cl)C=CC(=C2)OC)CC(=O)O |
Computed by PubChem (NCBI)