CAS 847503-17-7 appears in our catalog under these names: 7-Chloro-2-(2,5-dimethoxyphenyl)-8-methylquinoline-4-carboxylic acid, 95%, 7-Chloro-2-(2,5-dimethoxyphenyl)-8-methylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
7-chloro-2-(2,5-dimethoxyphenyl)-8-methylquinoline-4-carboxylic acid (CAS 847503-17-7) is a chemical compound with the molecular formula C19H16ClNO4 and a molecular weight of 357.8 g/mol. IUPAC name: 7-chloro-2-(2,5-dimethoxyphenyl)-8-methylquinoline-4-carboxylic acid. InChIKey: KJMXLJAJNHCRNO-UHFFFAOYSA-N.
| Molecular formula | C19H16ClNO4 |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 7-chloro-2-(2,5-dimethoxyphenyl)-8-methylquinoline-4-carboxylic acid |
| InChIKey | KJMXLJAJNHCRNO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1N=C(C=C2C(=O)O)C3=C(C=CC(=C3)OC)OC)Cl |
Computed by PubChem (NCBI)