Products 808120-35-6
CAS 808120-35-6 is the registry number for 2,3,4,5-Tetrahydro-1,5-methano-1H-3-benzazepine-7,8-diamine. Offered by: TRC. Available pack sizes: 750mg.
10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene-4,5-diamine (CAS 808120-35-6) is a chemical compound with the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. IUPAC name: 10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene-4,5-diamine. InChIKey: RGSRFWBFYAKENV-UHFFFAOYSA-N.
| Molecular formula | C11H15N3 |
|---|---|
| Molecular weight | 189.26 g/mol |
| IUPAC name | 10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene-4,5-diamine |
| InChIKey | RGSRFWBFYAKENV-UHFFFAOYSA-N |
| SMILES | C1C2CNCC1C3=CC(=C(C=C23)N)N |
Computed by PubChem (NCBI)