Products 80816-30-4

CAS 80816-30-4 is the registry number for 3-Phenyl-4-pentenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

3-phenylpent-4-en-1-ol (CAS 80816-30-4) is a chemical compound with the molecular formula C11H14O and a molecular weight of 162.23 g/mol. IUPAC name: 3-phenylpent-4-en-1-ol. InChIKey: QRXBBALNLZYDPW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O
Molecular weight162.23 g/mol
IUPAC name3-phenylpent-4-en-1-ol
InChIKeyQRXBBALNLZYDPW-UHFFFAOYSA-N
SMILESC=CC(CCO)C1=CC=CC=C1

Computed by PubChem (NCBI)