CAS 80866-77-9 appears in our catalog under these names: 2–Chloro–6–nitroanisole, 2-Chloro-6-nitroanisole, 2-Chloro-6-nitroanisole 97%, 2-Chloro-6-nitroanisole, 97%, 97%, 2-Chloro-6-nitroanisole, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 50g, 5g, 100g, 1g.
1-chloro-2-methoxy-3-nitrobenzene (CAS 80866-77-9) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 1-chloro-2-methoxy-3-nitrobenzene. InChIKey: MSBUQNLLSANFDL-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 1-chloro-2-methoxy-3-nitrobenzene |
| InChIKey | MSBUQNLLSANFDL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)