CAS 80879-86-3 appears in our catalog under these names: 2,3-Dimethyl-4-nitroaniline, 98%, 2,3–Dimethyl–4–Nitroaniline, 2,3-Dimethyl-4-nitroaniline 98%, Benzenamine, 2,3-dimethyl-4-nitro-, 98%, 98%, 2,3-Dimethyl-4-nitroaniline, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 2.5g.
2,3-dimethyl-4-nitroaniline (CAS 80879-86-3) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2,3-dimethyl-4-nitroaniline. InChIKey: XXIWYZBTCKMAMY-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2,3-dimethyl-4-nitroaniline |
| InChIKey | XXIWYZBTCKMAMY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)[N+](=O)[O-])N |
Computed by PubChem (NCBI)