Products 80948-70-5
CAS 80948-70-5 appears in our catalog under these names: Doxorubicin Impurity 33, Doxorubicin Impurity 28, Doxorubicin Impurity 20. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(7S)-6,7,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-7,8-dihydrotetracene-5,12-dione (CAS 80948-70-5) is a chemical compound with the molecular formula C21H16O8 and a molecular weight of 396.3 g/mol. IUPAC name: (7S)-6,7,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-7,8-dihydrotetracene-5,12-dione. InChIKey: NTOLAONTQPUUEN-NSHDSACASA-N.
| Molecular formula | C21H16O8 |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | (7S)-6,7,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-7,8-dihydrotetracene-5,12-dione |
| InChIKey | NTOLAONTQPUUEN-NSHDSACASA-N |
| SMILES | COC1=CC=CC2=C1C(=O)C3=C(C4=C(C=C(C[C@@H]4O)C(=O)CO)C(=C3C2=O)O)O |
Computed by PubChem (NCBI)