Products 32469-41-3
CAS 32469-41-3 appears in our catalog under these names: Epirubicin Impurity 10, (S)-3-Acetyl-3,4-dihydro-3,5,12-trihydroxy-10-methoxy-1,6,11(2H)-naphthacenetrione (90%). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1mg, 2,5mg, 5mg.
(3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-2,4-dihydrotetracene-1,6,11-trione (CAS 32469-41-3) is a chemical compound with the molecular formula C21H16O8 and a molecular weight of 396.3 g/mol. IUPAC name: (3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-2,4-dihydrotetracene-1,6,11-trione. InChIKey: MXWGWQIBIUNUNE-NRFANRHFSA-N.
| Molecular formula | C21H16O8 |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | (3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-2,4-dihydrotetracene-1,6,11-trione |
| InChIKey | MXWGWQIBIUNUNE-NRFANRHFSA-N |
| SMILES | CC(=O)[C@@]1(CC2=C(C(=O)C1)C(=C3C(=C2O)C(=O)C4=C(C3=O)C(=CC=C4)OC)O)O |
Computed by PubChem (NCBI)