CAS 6030-60-0 appears in our catalog under these names: Emodin Triacetate, Diacerein Impurity 9(Emodin Triacetate), Emodin Triacetate, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 500mg.
(4,5-diacetyloxy-7-methyl-9,10-dioxoanthracen-2-yl) acetate (CAS 6030-60-0) is a chemical compound with the molecular formula C21H16O8 and a molecular weight of 396.3 g/mol. IUPAC name: (4,5-diacetyloxy-7-methyl-9,10-dioxoanthracen-2-yl) acetate. InChIKey: RVPRUQJQDGWKRY-UHFFFAOYSA-N.
| Molecular formula | C21H16O8 |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | (4,5-diacetyloxy-7-methyl-9,10-dioxoanthracen-2-yl) acetate |
| InChIKey | RVPRUQJQDGWKRY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)OC(=O)C)C(=O)C3=C(C2=O)C=C(C=C3OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)