CAS 81-42-5 appears in our catalog under these names: 1,4–Diamino–2,3–dichloroanthraquinone, 1,4-Diamino-2,3-dichloroanthraquinone, >93.0%(HPLC), 1,4-Diamino-2,3-dichloroanthraquinone 95%, 1,4-Diamino-2,3-dichloroanthracene-9,10-dione, 95%, 95%, 1,4-Diamino-2,3-dichloroanthracene-9,10-dione, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 50g, 75g, 200g, 300g, 500g.
1,4-diamino-2,3-dichloroanthracene-9,10-dione (CAS 81-42-5) is a chemical compound with the molecular formula C14H8Cl2N2O2 and a molecular weight of 307.1 g/mol. IUPAC name: 1,4-diamino-2,3-dichloroanthracene-9,10-dione. InChIKey: KZYAYVSWIPZDKL-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2N2O2 |
|---|---|
| Molecular weight | 307.1 g/mol |
| IUPAC name | 1,4-diamino-2,3-dichloroanthracene-9,10-dione |
| InChIKey | KZYAYVSWIPZDKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C(=C3N)Cl)Cl)N |
Computed by PubChem (NCBI)