CAS 81142-32-7 appears in our catalog under these names: 4-(Bromomethyl)-2,6-di-tert-butylpyridine, 95%, 4-(Bromomethyl)-2,6-di-tert-butylpyridine, 4–(Bromomethyl)–2,6–di–tert–butylpyridine. Offered by: Combi-blocks, TRC, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 2,5g.
4-(bromomethyl)-2,6-ditert-butylpyridine (CAS 81142-32-7) is a chemical compound with the molecular formula C14H22BrN and a molecular weight of 284.23 g/mol. IUPAC name: 4-(bromomethyl)-2,6-ditert-butylpyridine. InChIKey: KRGQGAXLBUQGQP-UHFFFAOYSA-N.
| Molecular formula | C14H22BrN |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | 4-(bromomethyl)-2,6-ditert-butylpyridine |
| InChIKey | KRGQGAXLBUQGQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=N1)C(C)(C)C)CBr |
Computed by PubChem (NCBI)