CAS 930781-28-5 appears in our catalog under these names: 4-Bromo-N,N-dimethyl-2,6-di(propan-2-yl)aniline, 95-<97%, 4-Bromo-2,6-diisopropyl-N,N-dimethylaniline, 98%. Offered by: Hoffman Fine Chemicals, Chemat Brand. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, on request.
4-bromo-N,N-dimethyl-2,6-di(propan-2-yl)aniline (CAS 930781-28-5) is a chemical compound with the molecular formula C14H22BrN and a molecular weight of 284.23 g/mol. IUPAC name: 4-bromo-N,N-dimethyl-2,6-di(propan-2-yl)aniline. InChIKey: SPLBLQVTASYPBB-UHFFFAOYSA-N.
| Molecular formula | C14H22BrN |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | 4-bromo-N,N-dimethyl-2,6-di(propan-2-yl)aniline |
| InChIKey | SPLBLQVTASYPBB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N(C)C)C(C)C)Br |
Computed by PubChem (NCBI)