Products 81335-78-6
CAS 81335-78-6 appears in our catalog under these names: Imazamox Impurity 13, Desmethyl Imazamox, Imazamox-O-desmethyl, Imazamox Metabolite M720H001. Offered by: Hubei YoungXin, TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1x10mg.
5-(hydroxymethyl)-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid (CAS 81335-78-6) is a chemical compound with the molecular formula C14H17N3O4 and a molecular weight of 291.30 g/mol. IUPAC name: 5-(hydroxymethyl)-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid. InChIKey: XQOJIMLCWGIOCP-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O4 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 5-(hydroxymethyl)-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid |
| InChIKey | XQOJIMLCWGIOCP-UHFFFAOYSA-N |
| SMILES | CC(C)C1(C(=O)NC(=N1)C2=C(C=C(C=N2)CO)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Desmethyl Imazamox, Imazamox-O-desmethyl