CAS 81381-72-8 is the registry number for (4-Methoxyphenyl)methylbeta-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(4-methoxyphenyl)methoxy]oxane-3,4,5-triol (CAS 81381-72-8) is a chemical compound with the molecular formula C14H20O7 and a molecular weight of 300.30 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(4-methoxyphenyl)methoxy]oxane-3,4,5-triol. InChIKey: GRBSGJQPRONUPW-RKQHYHRCSA-N.
| Molecular formula | C14H20O7 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(4-methoxyphenyl)methoxy]oxane-3,4,5-triol |
| InChIKey | GRBSGJQPRONUPW-RKQHYHRCSA-N |
| SMILES | COC1=CC=C(C=C1)CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)