CAS 883434-90-0 is the registry number for Grahamimycin B. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3E,6R,9R,12R,14S)-9,12-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradec-3-ene-2,8,11-trione (CAS 883434-90-0) is a chemical compound with the molecular formula C14H20O7 and a molecular weight of 300.30 g/mol. IUPAC name: (3E,6R,9R,12R,14S)-9,12-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradec-3-ene-2,8,11-trione. InChIKey: UPKYFPVASUJJTL-KFQHZJPOSA-N.
| Molecular formula | C14H20O7 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | (3E,6R,9R,12R,14S)-9,12-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradec-3-ene-2,8,11-trione |
| InChIKey | UPKYFPVASUJJTL-KFQHZJPOSA-N |
| SMILES | C[C@@H]1C/C=C/C(=O)O[C@H](C[C@H](C(=O)C[C@H](C(=O)O1)O)O)C |
Computed by PubChem (NCBI)