Products 81390-93-4
CAS 81390-93-4 is the registry number for (3,5-Bis(trifluoromethyl)phenyl)(phenyl)methanol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
[3,5-bis(trifluoromethyl)phenyl]-phenylmethanol (CAS 81390-93-4) is a chemical compound with the molecular formula C15H10F6O and a molecular weight of 320.23 g/mol. IUPAC name: [3,5-bis(trifluoromethyl)phenyl]-phenylmethanol. InChIKey: IJECXTZHVDMNGS-UHFFFAOYSA-N.
| Molecular formula | C15H10F6O |
|---|---|
| Molecular weight | 320.23 g/mol |
| IUPAC name | [3,5-bis(trifluoromethyl)phenyl]-phenylmethanol |
| InChIKey | IJECXTZHVDMNGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)O |
Computed by PubChem (NCBI)