CAS 910291-18-8 is the registry number for 2-([1,1'-Biphenyl]-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,1,3,3,3-hexafluoro-2-(2-phenylphenyl)propan-2-ol (CAS 910291-18-8) is a chemical compound with the molecular formula C15H10F6O and a molecular weight of 320.23 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoro-2-(2-phenylphenyl)propan-2-ol. InChIKey: WGVVVRAWUILFJD-UHFFFAOYSA-N.
| Molecular formula | C15H10F6O |
|---|---|
| Molecular weight | 320.23 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoro-2-(2-phenylphenyl)propan-2-ol |
| InChIKey | WGVVVRAWUILFJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)