Products 81436-40-0
CAS 81436-40-0 is the registry number for (9E)-Strobilurin A. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2E,3E,5E)-2-(methoxymethylidene)-3-methyl-6-phenylhexa-3,5-dienoate (CAS 81436-40-0) is a chemical compound with the molecular formula C16H18O3 and a molecular weight of 258.31 g/mol. IUPAC name: methyl (2E,3E,5E)-2-(methoxymethylidene)-3-methyl-6-phenylhexa-3,5-dienoate. InChIKey: JSCQSBGXKRTPHZ-MGYGFCQBSA-N.
| Molecular formula | C16H18O3 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | methyl (2E,3E,5E)-2-(methoxymethylidene)-3-methyl-6-phenylhexa-3,5-dienoate |
| InChIKey | JSCQSBGXKRTPHZ-MGYGFCQBSA-N |
| SMILES | C/C(=C\C=C\C1=CC=CC=C1)/C(=C\OC)/C(=O)OC |
Computed by PubChem (NCBI)