CAS 1379811-64-9 is the registry number for 4-(4-Isopropylphenyl)-2,5-dimethyl-3-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,5-dimethyl-4-(4-propan-2-ylphenyl)furan-3-carboxylic acid (CAS 1379811-64-9) is a chemical compound with the molecular formula C16H18O3 and a molecular weight of 258.31 g/mol. IUPAC name: 2,5-dimethyl-4-(4-propan-2-ylphenyl)furan-3-carboxylic acid. InChIKey: PRSJLZXQSIGRTM-UHFFFAOYSA-N.
| Molecular formula | C16H18O3 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 2,5-dimethyl-4-(4-propan-2-ylphenyl)furan-3-carboxylic acid |
| InChIKey | PRSJLZXQSIGRTM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(O1)C)C(=O)O)C2=CC=C(C=C2)C(C)C |
Computed by PubChem (NCBI)