Products 1122065-27-3
CAS 1122065-27-3 is the registry number for 7-Methoxy-2-naphthalenyl 2,2-dimethylpropanoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
(7-methoxynaphthalen-2-yl) 2,2-dimethylpropanoate (CAS 1122065-27-3) is a chemical compound with the molecular formula C16H18O3 and a molecular weight of 258.31 g/mol. IUPAC name: (7-methoxynaphthalen-2-yl) 2,2-dimethylpropanoate. InChIKey: NMGXHLOCEGVQBH-UHFFFAOYSA-N.
| Molecular formula | C16H18O3 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | (7-methoxynaphthalen-2-yl) 2,2-dimethylpropanoate |
| InChIKey | NMGXHLOCEGVQBH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC2=C(C=CC(=C2)OC)C=C1 |
Computed by PubChem (NCBI)