Products 815576-68-2
CAS 815576-68-2 appears in our catalog under these names: Quinolactacin A1, (+)–Quinolactacin A1. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 75mg, 1mg, 5mg, Get quote.
(3R)-3-[(2S)-butan-2-yl]-4-methyl-2,3-dihydropyrrolo[3,4-b]quinoline-1,9-dione (CAS 815576-68-2) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: (3R)-3-[(2S)-butan-2-yl]-4-methyl-2,3-dihydropyrrolo[3,4-b]quinoline-1,9-dione. InChIKey: FLHQAMWKNPOTDV-TVQRCGJNSA-N.
| Molecular formula | C16H18N2O2 |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | (3R)-3-[(2S)-butan-2-yl]-4-methyl-2,3-dihydropyrrolo[3,4-b]quinoline-1,9-dione |
| InChIKey | FLHQAMWKNPOTDV-TVQRCGJNSA-N |
| SMILES | CC[C@H](C)[C@@H]1C2=C(C(=O)C3=CC=CC=C3N2C)C(=O)N1 |
Computed by PubChem (NCBI)