CAS 81616-78-6 is the registry number for N,N-Dimethyl-2-phenylacrylamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-dimethyl-2-phenylprop-2-enamide (CAS 81616-78-6) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: N,N-dimethyl-2-phenylprop-2-enamide. InChIKey: KPDZXSXNRIVAAX-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | N,N-dimethyl-2-phenylprop-2-enamide |
| InChIKey | KPDZXSXNRIVAAX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C(=C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)