CAS 81659-82-7 appears in our catalog under these names: Boc-Glu(OSu)-OtBu, Boc–Glu(OSu)–OtBu, Boc-Glu(Osu)-OtBu 95%, Boc-Glu(Osu)-Otbu, 95%, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 25g, 5g, 250mg.
1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (CAS 81659-82-7) is a chemical compound with the molecular formula C18H28N2O8 and a molecular weight of 400.4 g/mol. IUPAC name: 1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate. InChIKey: ZZGDWIAZPUAPHR-NSHDSACASA-N.
| Molecular formula | C18H28N2O8 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | 1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| InChIKey | ZZGDWIAZPUAPHR-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)ON1C(=O)CCC1=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)