Products 129101-54-8
CAS 129101-54-8 appears in our catalog under these names: Rivastigmine Tartrate, Rivastigmine Hydrogen Tartrate, Rivastigmine Tartrate Salt, Rivastigmine tartrate/ 99.66% (existing batch purity), Rivastigmine Tartrate. Offered by: Chemat Brand, Mikromol, LoGiCal, TRC, TargetMol. Available pack sizes: on request, 250mg, 10mg, 100mg, 50mg, 25mg, 200mg, 10mM (in 1ml dmso).
(2R,3R)-2,3-dihydroxybutanedioic acid;[3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate (CAS 129101-54-8) is a chemical compound with the molecular formula C18H28N2O8 and a molecular weight of 400.4 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;[3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate. InChIKey: GWHQHAUAXRMMOT-MBANBULQSA-N.
| Molecular formula | C18H28N2O8 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;[3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate |
| InChIKey | GWHQHAUAXRMMOT-MBANBULQSA-N |
| SMILES | CCN(C)C(=O)OC1=CC=CC(=C1)[C@H](C)N(C)C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)