Products 81732-54-9
CAS 81732-54-9 appears in our catalog under these names: Terbutaline Impurity 11, Terbutaline Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-hydroxy-5-phenylmethoxyphenyl)ethanone (CAS 81732-54-9) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 1-(3-hydroxy-5-phenylmethoxyphenyl)ethanone. InChIKey: QFNYESIGGWFJBI-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 1-(3-hydroxy-5-phenylmethoxyphenyl)ethanone |
| InChIKey | QFNYESIGGWFJBI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)