CAS 819058-34-9 appears in our catalog under these names: 4-Amino-3-fluorobenzeneboronic acid pinacol ester, 96% , 4-Amino-3-fluorophenylboronic acid pinacol ester, 97%, 4-Amino-3-fluorophenylboronic acid, pinacol ester, 98%, 98%, 4-Amino-3-fluorophenylboronic acid pinacol ester, 95%. Offered by: Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g, 50g, 100g.
2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 819058-34-9) is a chemical compound with the molecular formula C12H17BFNO2 and a molecular weight of 237.08 g/mol. IUPAC name: 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: AIXGNRNTXUKZLC-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO2 |
|---|---|
| Molecular weight | 237.08 g/mol |
| IUPAC name | 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | AIXGNRNTXUKZLC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)F |
Computed by PubChem (NCBI)