CAS 81937-32-8 appears in our catalog under these names: 2-(3-Fluoro-4-nitrophenyl)propanoic acid, 95%, 95%, 2-(3-FLUORO-4-NITROPHENYL)PROPANOIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-(3-fluoro-4-nitrophenyl)propanoic acid (CAS 81937-32-8) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: 2-(3-fluoro-4-nitrophenyl)propanoic acid. InChIKey: GALSVFOXBFKMEG-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 2-(3-fluoro-4-nitrophenyl)propanoic acid |
| InChIKey | GALSVFOXBFKMEG-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)[N+](=O)[O-])F)C(=O)O |
Computed by PubChem (NCBI)