CAS 82-73-5 appears in our catalog under these names: 3-Bromophthalic Anhydride, >95% (HPLC), 3-Bromophthalic Anhydride, >98.0%(GC), 4-Bromoisobenzofuran-1,3-dione 97%, 4-bromo-1,3-dihydro-2-benzofuran-1,3-dione, 97%, 97%, 3-Bromophthalic anhydride, 97%. Offered by: TRC, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 500g, 25g, 100g, 250mg, 50g.
4-bromo-2-benzofuran-1,3-dione (CAS 82-73-5) is a chemical compound with the molecular formula C8H3BrO3 and a molecular weight of 227.01 g/mol. IUPAC name: 4-bromo-2-benzofuran-1,3-dione. InChIKey: AQBFKBMMIDHCFS-UHFFFAOYSA-N.
| Molecular formula | C8H3BrO3 |
|---|---|
| Molecular weight | 227.01 g/mol |
| IUPAC name | 4-bromo-2-benzofuran-1,3-dione |
| InChIKey | AQBFKBMMIDHCFS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)OC2=O |
Computed by PubChem (NCBI)