CAS 86-90-8 appears in our catalog under these names: 4-Bromophthalic anhydride, 97%, 4–Bromophthalic Anhydride, 4-Bromophthalic Anhydride, >97.0%(GC), 5-Bromoisobenzofuran-1,3-dione 97%, 4-Bromophthalic anhydride, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 500g, 5g, 1000g, 10g, 50g, 1kg.
5-bromo-2-benzofuran-1,3-dione (CAS 86-90-8) is a chemical compound with the molecular formula C8H3BrO3 and a molecular weight of 227.01 g/mol. IUPAC name: 5-bromo-2-benzofuran-1,3-dione. InChIKey: BCKVHOUUJMYIAN-UHFFFAOYSA-N.
| Molecular formula | C8H3BrO3 |
|---|---|
| Molecular weight | 227.01 g/mol |
| IUPAC name | 5-bromo-2-benzofuran-1,3-dione |
| InChIKey | BCKVHOUUJMYIAN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)OC2=O |
Computed by PubChem (NCBI)