CAS 82-98-4 appears in our catalog under these names: Piperidolate/ 98%, Piperidolate, Piperidolate (Standard), Piperidolate, 98.45% ,, 98.45% ,, Piperidolate, 99.34%. Offered by: TargetMol, Chemat Brand, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, on request, 10mM (in 1ml dmso), 200mg, 500mg.
(1-ethylpiperidin-3-yl) 2,2-diphenylacetate (CAS 82-98-4) is a chemical compound with the molecular formula C21H25NO2 and a molecular weight of 323.4 g/mol. IUPAC name: (1-ethylpiperidin-3-yl) 2,2-diphenylacetate. InChIKey: KTHVBAZBLKXIHZ-UHFFFAOYSA-N.
| Molecular formula | C21H25NO2 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (1-ethylpiperidin-3-yl) 2,2-diphenylacetate |
| InChIKey | KTHVBAZBLKXIHZ-UHFFFAOYSA-N |
| SMILES | CCN1CCCC(C1)OC(=O)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)