Products 82872-70-6

CAS 82872-70-6 is the registry number for Benproperine phosphate Impurity A. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Phenyl-[2-(2-piperidin-1-ylpropoxy)phenyl]methanone (CAS 82872-70-6) is a chemical compound with the molecular formula C21H25NO2 and a molecular weight of 323.4 g/mol. IUPAC name: phenyl-[2-(2-piperidin-1-ylpropoxy)phenyl]methanone. InChIKey: GXXVJKIOCGZKIE-UHFFFAOYSA-N.

Identity
Molecular formulaC21H25NO2
Molecular weight323.4 g/mol
IUPAC namephenyl-[2-(2-piperidin-1-ylpropoxy)phenyl]methanone
InChIKeyGXXVJKIOCGZKIE-UHFFFAOYSA-N
SMILESCC(COC1=CC=CC=C1C(=O)C2=CC=CC=C2)N3CCCCC3

Computed by PubChem (NCBI)