Products 82079-83-2
CAS 82079-83-2 is the registry number for (+)-8-Demethylisoambrox. Offered by: TRC. Available pack sizes: 75mg.
(3aS,5aS,9aS,9bR)-6,6,9a-trimethyl-1,2,3a,4,5,5a,7,8,9,9b-decahydrobenzo[e][1]benzofuran (CAS 82079-83-2) is a chemical compound with the molecular formula C15H26O and a molecular weight of 222.37 g/mol. IUPAC name: (3aS,5aS,9aS,9bR)-6,6,9a-trimethyl-1,2,3a,4,5,5a,7,8,9,9b-decahydrobenzo[e][1]benzofuran. InChIKey: IPEPBOBQYDJNON-PWNZVWSESA-N.
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | (3aS,5aS,9aS,9bR)-6,6,9a-trimethyl-1,2,3a,4,5,5a,7,8,9,9b-decahydrobenzo[e][1]benzofuran |
| InChIKey | IPEPBOBQYDJNON-PWNZVWSESA-N |
| SMILES | C[C@]12CCCC([C@@H]1CC[C@H]3[C@@H]2CCO3)(C)C |
Computed by PubChem (NCBI)