CAS 82145-84-4 appears in our catalog under these names: 4-[(1,3-Benzothiazol-2-ylthio)methyl]benzoic acid, 95%, 4-((1,3-Benzothiazol-2-ylsulfanyl)methyl)benzoic acid, 97%, 4-[(1,3-Benzothiazol-2-ylsulfanyl)methyl]benzoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 500mg.
4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoic acid (CAS 82145-84-4) is a chemical compound with the molecular formula C15H11NO2S2 and a molecular weight of 301.4 g/mol. IUPAC name: 4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoic acid. InChIKey: XAZGUJUGDDLSEK-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S2 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoic acid |
| InChIKey | XAZGUJUGDDLSEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SCC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)