CAS 930543-12-7 appears in our catalog under these names: 2-(4-Phenyl-2-(thiophen-2-yl)-1,3-thiazol-5-yl)acetic acid, 95%, 2-(4-Phenyl-2-(thiophen-2-yl)-1,3-thiazol-5-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(4-phenyl-2-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid (CAS 930543-12-7) is a chemical compound with the molecular formula C15H11NO2S2 and a molecular weight of 301.4 g/mol. IUPAC name: 2-(4-phenyl-2-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid. InChIKey: BOFQVNNXEDLSGY-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S2 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 2-(4-phenyl-2-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid |
| InChIKey | BOFQVNNXEDLSGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)C3=CC=CS3)CC(=O)O |
Computed by PubChem (NCBI)