CAS 823198-78-3 appears in our catalog under these names: 2-Methyl-6-((3-methoxyphenyl)ethynyl)pyridine Hydrochloride, 2-((3-Methoxyphenyl)ethynyl)-6-methylpyridine hydrochloride, 98%, MMPEP 98%, 2-((3-Methoxyphenyl)ethynyl)-6-methylpyridine hydrochloride, 98%, 98%. Offered by: TRC, Fluorochem, Ambeed, Chemat. Available pack sizes: 10mg, 2mg, 5mg, 1mg, 100mg, 250mg, 1g.
2-[2-(3-methoxyphenyl)ethynyl]-6-methylpyridine;hydrochloride (CAS 823198-78-3) is a chemical compound with the molecular formula C15H14ClNO and a molecular weight of 259.73 g/mol. IUPAC name: 2-[2-(3-methoxyphenyl)ethynyl]-6-methylpyridine;hydrochloride. InChIKey: BWGVEMBFNIKUJU-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 2-[2-(3-methoxyphenyl)ethynyl]-6-methylpyridine;hydrochloride |
| InChIKey | BWGVEMBFNIKUJU-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C#CC2=CC(=CC=C2)OC.Cl |
Computed by PubChem (NCBI)