Products 82344-82-9
CAS 82344-82-9 appears in our catalog under these names: Coelonin, 4-Methoxy-9,10-dihydrophenanthrene-2,7-diol, Coelonin, 98.0%. Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 500mg, 10mg, 5mg, 25mg, 1mg, 5 mg, 1 mg.
4-methoxy-9,10-dihydrophenanthrene-2,7-diol (CAS 82344-82-9) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 4-methoxy-9,10-dihydrophenanthrene-2,7-diol. InChIKey: OPPGAHUCKDKQJR-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 4-methoxy-9,10-dihydrophenanthrene-2,7-diol |
| InChIKey | OPPGAHUCKDKQJR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1C3=C(CC2)C=C(C=C3)O)O |
Computed by PubChem (NCBI)