Products 82375-29-9
CAS 82375-29-9 appears in our catalog under these names: Humantenine, Humantenine, 98%, Humantenine, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 5 mg, 25 mg, 10 mg, 1 mg.
(1R,2S,4S,7Z,8R,9S)-7-ethylidene-1'-methoxy-5-methylspiro[11-oxa-5-azatricyclo[6.3.1.04,9]dodecane-2,3'-indole]-2'-one (CAS 82375-29-9) is a chemical compound with the molecular formula C21H26N2O3 and a molecular weight of 354.4 g/mol. IUPAC name: (1R,2S,4S,7Z,8R,9S)-7-ethylidene-1'-methoxy-5-methylspiro[11-oxa-5-azatricyclo[6.3.1.04,9]dodecane-2,3'-indole]-2'-one. InChIKey: SJKRPUOXUNOPOP-YDAOCWKESA-N.
| Molecular formula | C21H26N2O3 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (1R,2S,4S,7Z,8R,9S)-7-ethylidene-1'-methoxy-5-methylspiro[11-oxa-5-azatricyclo[6.3.1.04,9]dodecane-2,3'-indole]-2'-one |
| InChIKey | SJKRPUOXUNOPOP-YDAOCWKESA-N |
| SMILES | C/C=C/1\CN([C@H]2C[C@@]3([C@H]4C[C@@H]1[C@@H]2CO4)C5=CC=CC=C5N(C3=O)OC)C |
Computed by PubChem (NCBI)